About 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile
4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile (PubChem CID 118556989) has the molecular formula C22H34N2
and a molecular weight of 326.53 g/mol. Its IUPAC name is 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile.
Molecular Properties
| Compound Name | 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile |
| PubChem CID | 118556989 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile |
| SMILES | CC(=CCC#N)C1CCCCC1.CC(C=CC#N)C1CCCCC1 |
| InChI | InChI=1S/2C11H17N/c2*1-10(6-5-9-12)11-7-3-2-4-8-11/h6,11H,2-5,7-8H2,1H3;5-6,10-11H,2-4,7-8H2,1H3 |
| InChIKey | KJSBAKWBHBEXFX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile?
The IUPAC name of 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile (CID 118556989) is 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile.
What is the SMILES notation for 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile?
The canonical SMILES for 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile is CC(=CCC#N)C1CCCCC1.CC(C=CC#N)C1CCCCC1.
What is the InChIKey of 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile?
The InChIKey is KJSBAKWBHBEXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H17N/c2*1-10(6-5-9-12)11-7-3-2-4-8-11/h6,11H,2-5,7-8H2,1H3;5-6,10-11H,2-4,7-8H2,1H3.
What are the key properties of 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile?
4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile has a molecular weight of 326.53 g/mol, XLogP of 6.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylpent-2-enenitrile;4-cyclohexylpent-3-enenitrile is sourced from PubChem (CID 118556989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).