C25H32N6 — CID 11855711
(4aS,10bR)-1-[[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline (PubChem CID 11855711) has the molecular formula C25H32N6 and a molecular weight of 416.57 g/mol. Its IUPAC name is (4aS,10bR)-1-[[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline.
| Compound Name | (4aS,10bR)-1-[[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 11855711 |
| Molecular Formula | C25H32N6 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (4aS,10bR)-1-[[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
| SMILES | CN1CCN(c2cccc3nc(CN4CCC[C@@H]5CCc6cccnc6[C@@H]54)cn23)CC1 |
| InChI | InChI=1S/C25H32N6/c1-28-13-15-29(16-14-28)23-8-2-7-22-27-21(18-31(22)23)17-30-12-4-6-20-10-9-19-5-3-11-26-24(19)25(20)30/h2-3,5,7-8,11,18,20,25H,4,6,9-10,12-17H2,1H3/t20-,25-/m1/s1 |
| InChIKey | DEIGWGYLOIKCSS-CJFMBICVSA-N |
| XLogP | 3.38 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |