About N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide
N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide (PubChem CID 118557220) has the molecular formula C22H18N2O4
and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide.
Molecular Properties
| Compound Name | N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide |
| PubChem CID | 118557220 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide |
| SMILES | O=C(N[C@H]1COc2ccccc2NC1=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H18N2O4/c25-21(15-7-6-10-17(13-15)28-16-8-2-1-3-9-16)24-19-14-27-20-12-5-4-11-18(20)23-22(19)26/h1-13,19H,14H2,(H,23,26)(H,24,25)/t19-/m0/s1 |
| InChIKey | AWXYMMISTIIAIH-IBGZPJMESA-N |
| XLogP | 3.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide?
The IUPAC name of N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide (CID 118557220) is N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide.
What is the SMILES notation for N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide?
The canonical SMILES for N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide is O=C(N[C@H]1COc2ccccc2NC1=O)c1cccc(Oc2ccccc2)c1.
What is the InChIKey of N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide?
The InChIKey is AWXYMMISTIIAIH-IBGZPJMESA-N. The full InChI is InChI=1S/C22H18N2O4/c25-21(15-7-6-10-17(13-15)28-16-8-2-1-3-9-16)24-19-14-27-20-12-5-4-11-18(20)23-22(19)26/h1-13,19H,14H2,(H,23,26)(H,24,25)/t19-/m0/s1.
What are the key properties of N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide?
N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide has a molecular weight of 374.40 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-3-phenoxybenzamide is sourced from PubChem (CID 118557220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).