C24H25N3O2 — CID 11855747
2-anilino-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 11855747) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-anilino-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 2-anilino-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 11855747 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-anilino-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(N)=O)c(Nc3ccccc3)c1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C24H25N3O2/c1-15-11-19-21(13-24(2,3)14-22(19)28)27(15)17-9-10-18(23(25)29)20(12-17)26-16-7-5-4-6-8-16/h4-12,26H,13-14H2,1-3H3,(H2,25,29) |
| InChIKey | KWNGVSPUISEBNI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|