C9H10ClN5O2 — CID 118557497
N-[(7S)-4-chloro-5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-7-yl]formamide (PubChem CID 118557497) has the molecular formula C9H10ClN5O2 and a molecular weight of 255.66 g/mol. Its IUPAC name is N-[(7S)-4-chloro-5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-7-yl]formamide.
| Compound Name | N-[(7S)-4-chloro-5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-7-yl]formamide |
|---|---|
| PubChem CID | 118557497 |
| Molecular Formula | C9H10ClN5O2 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-[(7S)-4-chloro-5-methyl-6-oxo-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-7-yl]formamide |
| SMILES | CN1C(=O)[C@@H](NC=O)CNc2ncnc(Cl)c21 |
| InChI | InChI=1S/C9H10ClN5O2/c1-15-6-7(10)12-3-13-8(6)11-2-5(9(15)17)14-4-16/h3-5H,2H2,1H3,(H,14,16)(H,11,12,13)/t5-/m0/s1 |
| InChIKey | FHSNICHBKFBJEW-YFKPBYRVSA-N |
| XLogP | -0.37 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|