C30H29FN2O5 — CID 118558137
5-[6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-2-(3-methoxyphenyl)-1-oxoisoquinolin-3-yl]pentanoic acid (PubChem CID 118558137) has the molecular formula C30H29FN2O5 and a molecular weight of 516.57 g/mol. Its IUPAC name is 5-[6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-2-(3-methoxyphenyl)-1-oxoisoquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-2-(3-methoxyphenyl)-1-oxoisoquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 118558137 |
| Molecular Formula | C30H29FN2O5 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 5-[6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-2-(3-methoxyphenyl)-1-oxoisoquinolin-3-yl]pentanoic acid |
| SMILES | COc1cccc(-n2c(CCCCC(=O)O)cc3cc(C(=O)N[C@H](C)c4ccc(F)cc4)ccc3c2=O)c1 |
| InChI | InChI=1S/C30H29FN2O5/c1-19(20-10-13-23(31)14-11-20)32-29(36)21-12-15-27-22(16-21)17-24(6-3-4-9-28(34)35)33(30(27)37)25-7-5-8-26(18-25)38-2/h5,7-8,10-19H,3-4,6,9H2,1-2H3,(H,32,36)(H,34,35)/t19-/m1/s1 |
| InChIKey | DOKVJJBSEMHNGP-LJQANCHMSA-N |
| XLogP | 5.43 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|