C29H31F3N6O2 — CID 118558528
6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1S)-1-phenylpropyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid (PubChem CID 118558528) has the molecular formula C29H31F3N6O2 and a molecular weight of 552.60 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1S)-1-phenylpropyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1S)-1-phenylpropyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 118558528 |
| Molecular Formula | C29H31F3N6O2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1S)-1-phenylpropyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
| SMILES | CC[C@H](Nc1nc2nc(C(=O)O)nc(N[C@H](C)C3CCC3)c2n1Cc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H31F3N6O2/c1-3-22(20-8-5-4-6-9-20)34-28-37-25-23(38(28)16-18-12-14-21(15-13-18)29(30,31)32)24(35-26(36-25)27(39)40)33-17(2)19-10-7-11-19/h4-6,8-9,12-15,17,19,22H,3,7,10-11,16H2,1-2H3,(H,39,40)(H2,33,34,35,36,37)/t17-,22+/m1/s1 |
| InChIKey | HIYNGUONAJHUKM-VGSWGCGISA-N |
| XLogP | 6.76 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |