C25H18FN3O4 — CID 11855901
4-(4-fluorophenyl)-7-[[[5-[hydroxy(phenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one (PubChem CID 11855901) has the molecular formula C25H18FN3O4 and a molecular weight of 443.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-7-[[[5-[hydroxy(phenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one.
| Compound Name | 4-(4-fluorophenyl)-7-[[[5-[hydroxy(phenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 11855901 |
| Molecular Formula | C25H18FN3O4 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-(4-fluorophenyl)-7-[[[5-[hydroxy(phenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2)c2ccc(CNc3nnc(C(O)c4ccccc4)o3)cc2o1 |
| InChI | InChI=1S/C25H18FN3O4/c26-18-9-7-16(8-10-18)20-13-22(30)32-21-12-15(6-11-19(20)21)14-27-25-29-28-24(33-25)23(31)17-4-2-1-3-5-17/h1-13,23,31H,14H2,(H,27,29) |
| InChIKey | ZYGRPNIRUOZREE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|