C27H33F3N6O2 — CID 11855988
(4aS,10bS)-1-[[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline;2,2,2-trifluoroacetic acid (PubChem CID 11855988) has the molecular formula C27H33F3N6O2 and a molecular weight of 530.60 g/mol. Its IUPAC name is (4aS,10bS)-1-[[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,10bS)-1-[[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11855988 |
| Molecular Formula | C27H33F3N6O2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (4aS,10bS)-1-[[4-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(c2cccc3[nH]c(CN4CCC[C@@H]5CCc6cccnc6[C@H]54)nc23)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H32N6.C2HF3O2/c1-29-13-15-30(16-14-29)21-8-2-7-20-24(21)28-22(27-20)17-31-12-4-6-19-10-9-18-5-3-11-26-23(18)25(19)31;3-2(4,5)1(6)7/h2-3,5,7-8,11,19,25H,4,6,9-10,12-17H2,1H3,(H,27,28);(H,6,7)/t19-,25+;/m1./s1 |
| InChIKey | DYRCVWONZMEVHC-UFABNHQSSA-N |
| XLogP | 4.24 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |