C23H20FN5O — CID 118560359
N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-2-[4-(5-methylpyrimidin-4-yl)phenyl]acetamide (PubChem CID 118560359) has the molecular formula C23H20FN5O and a molecular weight of 401.45 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-2-[4-(5-methylpyrimidin-4-yl)phenyl]acetamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-2-[4-(5-methylpyrimidin-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 118560359 |
| Molecular Formula | C23H20FN5O |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-2-[4-(5-methylpyrimidin-4-yl)phenyl]acetamide |
| SMILES | Cc1cncnc1-c1ccc(CC(=O)Nc2ccn(Cc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C23H20FN5O/c1-16-13-25-15-26-23(16)19-6-2-17(3-7-19)12-22(30)27-21-10-11-29(28-21)14-18-4-8-20(24)9-5-18/h2-11,13,15H,12,14H2,1H3,(H,27,28,30) |
| InChIKey | LQCWAFINOKJWHM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |