About 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide
2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide (PubChem CID 118560840) has the molecular formula C22H17FN4O3
and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide |
| PubChem CID | 118560840 |
| Molecular Formula | C22H17FN4O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(-c3cccc(F)c3)nn2)c2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C22H17FN4O3/c1-12-8-14(20-16(9-12)21(29)27(2)22(20)30)11-19(28)24-18-7-6-17(25-26-18)13-4-3-5-15(23)10-13/h3-10H,11H2,1-2H3,(H,24,26,28) |
| InChIKey | VHGAGVIZKKXDSM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide?
The IUPAC name of 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide (CID 118560840) is 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide.
What is the SMILES notation for 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide?
The canonical SMILES for 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide is Cc1cc(CC(=O)Nc2ccc(-c3cccc(F)c3)nn2)c2c(c1)C(=O)N(C)C2=O.
What is the InChIKey of 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide?
The InChIKey is VHGAGVIZKKXDSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FN4O3/c1-12-8-14(20-16(9-12)21(29)27(2)22(20)30)11-19(28)24-18-7-6-17(25-26-18)13-4-3-5-15(23)10-13/h3-10H,11H2,1-2H3,(H,24,26,28).
What are the key properties of 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide?
2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide has a molecular weight of 404.40 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethyl-1,3-dioxoisoindol-4-yl)-N-[6-(3-fluorophenyl)pyridazin-3-yl]acetamide is sourced from PubChem (CID 118560840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).