C24H24N4O7 — CID 118561207
2-[4-(2-methoxyethylamino)-3-[[(2S)-pyrrolidine-2-carbonyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 118561207) has the molecular formula C24H24N4O7 and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-[4-(2-methoxyethylamino)-3-[[(2S)-pyrrolidine-2-carbonyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-(2-methoxyethylamino)-3-[[(2S)-pyrrolidine-2-carbonyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 118561207 |
| Molecular Formula | C24H24N4O7 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[4-(2-methoxyethylamino)-3-[[(2S)-pyrrolidine-2-carbonyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | COCCNc1ccc(N2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1C(=O)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C24H24N4O7/c1-35-10-9-26-18-7-5-14(12-17(18)20(29)27-21(30)19-3-2-8-25-19)28-22(31)15-6-4-13(24(33)34)11-16(15)23(28)32/h4-7,11-12,19,25-26H,2-3,8-10H2,1H3,(H,33,34)(H,27,29,30)/t19-/m0/s1 |
| InChIKey | YAIOTYDNZWGOME-IBGZPJMESA-N |
| XLogP | 1.25 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|