C24H27N3O6S — CID 11856141
(3R,4R)-N-hydroxy-3-methyl-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxane-3-carboxamide (PubChem CID 11856141) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is (3R,4R)-N-hydroxy-3-methyl-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxane-3-carboxamide.
| Compound Name | (3R,4R)-N-hydroxy-3-methyl-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxane-3-carboxamide |
|---|---|
| PubChem CID | 11856141 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (3R,4R)-N-hydroxy-3-methyl-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxane-3-carboxamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CCOC[C@]3(C)C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C24H27N3O6S/c1-16-13-17(20-5-3-4-6-21(20)25-16)14-33-18-7-9-19(10-8-18)34(30,31)27-22-11-12-32-15-24(22,2)23(28)26-29/h3-10,13,22,27,29H,11-12,14-15H2,1-2H3,(H,26,28)/t22-,24+/m1/s1 |
| InChIKey | AKDFMUYQSXECQD-VWNXMTODSA-N |
| XLogP | 2.70 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|