C16H10N2O2S — CID 118561719
4-phenyl-7H-thieno[3,2-b][1,6]naphthyridine-8,9-dione (PubChem CID 118561719) has the molecular formula C16H10N2O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-phenyl-7H-thieno[3,2-b][1,6]naphthyridine-8,9-dione.
| Compound Name | 4-phenyl-7H-thieno[3,2-b][1,6]naphthyridine-8,9-dione |
|---|---|
| PubChem CID | 118561719 |
| Molecular Formula | C16H10N2O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-phenyl-7H-thieno[3,2-b][1,6]naphthyridine-8,9-dione |
| SMILES | O=c1[nH]ccc2c1c(=O)c1sccc1n2-c1ccccc1 |
| InChI | InChI=1S/C16H10N2O2S/c19-14-13-11(6-8-17-16(13)20)18(10-4-2-1-3-5-10)12-7-9-21-15(12)14/h1-9H,(H,17,20) |
| InChIKey | MKHMBKUQLLHZGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |