C19H16ClF3N2O — CID 11856183
6-chloro-4-phenyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one (PubChem CID 11856183) has the molecular formula C19H16ClF3N2O and a molecular weight of 380.80 g/mol. Its IUPAC name is 6-chloro-4-phenyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one.
| Compound Name | 6-chloro-4-phenyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 11856183 |
| Molecular Formula | C19H16ClF3N2O |
| Molecular Weight | 380.80 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 6-chloro-4-phenyl-4-prop-2-enyl-3-(2,2,2-trifluoroethyl)-1H-quinazolin-2-one |
| SMILES | C=CCC1(c2ccccc2)c2cc(Cl)ccc2NC(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C19H16ClF3N2O/c1-2-10-18(13-6-4-3-5-7-13)15-11-14(20)8-9-16(15)24-17(26)25(18)12-19(21,22)23/h2-9,11H,1,10,12H2,(H,24,26) |
| InChIKey | QAECJCPOESPYOM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|