C25H27FN7O3S- — CID 118561866
(3S,6R)-6-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-3-cyclopropyl-3,6-dimethyl-4,4-dioxidothiomorpholin-4-ium-2-amine (PubChem CID 118561866) has the molecular formula C25H27FN7O3S- and a molecular weight of 524.60 g/mol. Its IUPAC name is (3S,6R)-6-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-3-cyclopropyl-3,6-dimethyl-4,4-dioxidothiomorpholin-4-ium-2-amine.
| Compound Name | (3S,6R)-6-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-3-cyclopropyl-3,6-dimethyl-4,4-dioxidothiomorpholin-4-ium-2-amine |
|---|---|
| PubChem CID | 118561866 |
| Molecular Formula | C25H27FN7O3S- |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (3S,6R)-6-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-3-cyclopropyl-3,6-dimethyl-4,4-dioxidothiomorpholin-4-ium-2-amine |
| SMILES | CC#CCOc1cnc2c(Nc3cnc(F)c([C@]4(C)C[N+]([O-])([O-])[C@@](C)(C5CC5)C(N)S4)c3)nccc2n1 |
| InChI | InChI=1S/C25H27FN7O3S/c1-4-5-10-36-19-13-29-20-18(32-19)8-9-28-22(20)31-16-11-17(21(26)30-12-16)24(2)14-33(34,35)25(3,15-6-7-15)23(27)37-24/h8-9,11-13,15,23H,6-7,10,14,27H2,1-3H3,(H,28,31)/q-1/t23?,24-,25-/m0/s1 |
| InChIKey | GKTYLMQTHVMTCR-DJHGOXGWSA-N |
| XLogP | 3.93 |
| TPSA | 144.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|