C27H39F3N2O11S — CID 118561915
[(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate;trifluoromethanesulfonate (PubChem CID 118561915) has the molecular formula C27H39F3N2O11S and a molecular weight of 656.67 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate;trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118561915 |
| Molecular Formula | C27H39F3N2O11S |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-bis(2,2-dimethylpropanoyloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate;trifluoromethanesulfonate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C26H38N2O8.CHF3O3S/c1-24(2,3)21(30)33-14-16-17(35-22(31)25(4,5)6)18(36-23(32)26(7,8)9)20(34-16)28-12-10-11-15(13-28)19(27)29;2-1(3,4)8(5,6)7/h10-13,16-18,20H,14H2,1-9H3,(H-,27,29);(H,5,6,7)/t16-,17-,18-,20-;/m1./s1 |
| InChIKey | RPJAXROMDBLJHP-XLZRZFRKSA-N |
| XLogP | 2.53 |
| TPSA | 192.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|