C24H33F3N2O11S — CID 118561917
[(2R,3R,4R,5R)-3,4-di(butanoyloxy)-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl butanoate;trifluoromethanesulfonate (PubChem CID 118561917) has the molecular formula C24H33F3N2O11S and a molecular weight of 614.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-di(butanoyloxy)-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl butanoate;trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-3,4-di(butanoyloxy)-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl butanoate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118561917 |
| Molecular Formula | C24H33F3N2O11S |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-di(butanoyloxy)-5-(3-carbamoylpyridin-1-ium-1-yl)oxolan-2-yl]methyl butanoate;trifluoromethanesulfonate |
| SMILES | CCCC(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](OC(=O)CCC)[C@@H]1OC(=O)CCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H32N2O8.CHF3O3S/c1-4-8-17(26)30-14-16-20(32-18(27)9-5-2)21(33-19(28)10-6-3)23(31-16)25-12-7-11-15(13-25)22(24)29;2-1(3,4)8(5,6)7/h7,11-13,16,20-21,23H,4-6,8-10,14H2,1-3H3,(H-,24,29);(H,5,6,7)/t16-,20-,21-,23-;/m1./s1 |
| InChIKey | YCHIYMRQPSHWST-URHPNRPLSA-N |
| XLogP | 1.79 |
| TPSA | 192.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|