C24H29NO4 — CID 118562064
methyl 4-[[[2-[(3-methoxyphenyl)methyl]cyclohexanecarbonyl]amino]methyl]benzoate (PubChem CID 118562064) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is methyl 4-[[[2-[(3-methoxyphenyl)methyl]cyclohexanecarbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[(3-methoxyphenyl)methyl]cyclohexanecarbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 118562064 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | methyl 4-[[[2-[(3-methoxyphenyl)methyl]cyclohexanecarbonyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C2CCCCC2Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-28-21-8-5-6-18(15-21)14-20-7-3-4-9-22(20)23(26)25-16-17-10-12-19(13-11-17)24(27)29-2/h5-6,8,10-13,15,20,22H,3-4,7,9,14,16H2,1-2H3,(H,25,26) |
| InChIKey | GOCCSYUBQLCWOQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |