About acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid
acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid (PubChem CID 118562479) has the molecular formula C12H22N2O5
and a molecular weight of 274.32 g/mol. Its IUPAC name is acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid.
Molecular Properties
| Compound Name | acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid |
| PubChem CID | 118562479 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid |
| SMILES | CC(=O)O.CC1CNCC2(CCN(C(=O)O)CC2)O1 |
| InChI | InChI=1S/C10H18N2O3.C2H4O2/c1-8-6-11-7-10(15-8)2-4-12(5-3-10)9(13)14;1-2(3)4/h8,11H,2-7H2,1H3,(H,13,14);1H3,(H,3,4) |
| InChIKey | BSIWILRHNXASQA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid?
The IUPAC name of acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid (CID 118562479) is acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid.
What is the SMILES notation for acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid?
The canonical SMILES for acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid is CC(=O)O.CC1CNCC2(CCN(C(=O)O)CC2)O1.
What is the InChIKey of acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid?
The InChIKey is BSIWILRHNXASQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3.C2H4O2/c1-8-6-11-7-10(15-8)2-4-12(5-3-10)9(13)14;1-2(3)4/h8,11H,2-7H2,1H3,(H,13,14);1H3,(H,3,4).
What are the key properties of acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid?
acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid has a molecular weight of 274.32 g/mol, XLogP of 0.60, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylic acid is sourced from PubChem (CID 118562479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).