About ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate
ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate (PubChem CID 118562782) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate |
| PubChem CID | 118562782 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate |
| SMILES | CCCC(C)(C)CC1=C(NNC(=O)OCC)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-5-7-13(3,4)9-10-8-11(10)14-15-12(16)17-6-2/h14H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | ZZTLZSYCGKMMFQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate?
The IUPAC name of ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate (CID 118562782) is ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate.
What is the SMILES notation for ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate?
The canonical SMILES for ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate is CCCC(C)(C)CC1=C(NNC(=O)OCC)C1.
What is the InChIKey of ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate?
The InChIKey is ZZTLZSYCGKMMFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-5-7-13(3,4)9-10-8-11(10)14-15-12(16)17-6-2/h14H,5-9H2,1-4H3,(H,15,16).
What are the key properties of ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate?
ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate has a molecular weight of 240.35 g/mol, XLogP of 3.11, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[2-(2,2-dimethylpentyl)cyclopropen-1-yl]amino]carbamate is sourced from PubChem (CID 118562782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).