About 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine
5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine (PubChem CID 118562952) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine.
Molecular Properties
| Compound Name | 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine |
| PubChem CID | 118562952 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine |
| SMILES | CCC1=C(C)CNCC=N1 |
| InChI | InChI=1S/C8H14N2/c1-3-8-7(2)6-9-4-5-10-8/h5,9H,3-4,6H2,1-2H3 |
| InChIKey | YGZNJLZJWLVFKA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine?
The IUPAC name of 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine (CID 118562952) is 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine.
What is the SMILES notation for 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine?
The canonical SMILES for 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine is CCC1=C(C)CNCC=N1.
What is the InChIKey of 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine?
The InChIKey is YGZNJLZJWLVFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-8-7(2)6-9-4-5-10-8/h5,9H,3-4,6H2,1-2H3.
What are the key properties of 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine?
5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine has a molecular weight of 138.21 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-methyl-2,7-dihydro-1H-1,4-diazepine is sourced from PubChem (CID 118562952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).