About methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate
methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 118562982) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
Molecular Properties
| Compound Name | methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| PubChem CID | 118562982 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)[C@@H](OC(C)(C)C)c1c(C)c(N)cc(C)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-13-8-10-16(11-9-13)18-14(2)12-17(23)15(3)19(18)20(21(24)25-7)26-22(4,5)6/h8-12,20H,23H2,1-7H3/t20-/m0/s1 |
| InChIKey | XEQMEBWYPPLCHD-FQEVSTJZSA-N |
| XLogP | 4.89 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
The IUPAC name of methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (CID 118562982) is methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
What is the SMILES notation for methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
The canonical SMILES for methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate is COC(=O)[C@@H](OC(C)(C)C)c1c(C)c(N)cc(C)c1-c1ccc(C)cc1.
What is the InChIKey of methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
The InChIKey is XEQMEBWYPPLCHD-FQEVSTJZSA-N. The full InChI is InChI=1S/C22H29NO3/c1-13-8-10-16(11-9-13)18-14(2)12-17(23)15(3)19(18)20(21(24)25-7)26-22(4,5)6/h8-12,20H,23H2,1-7H3/t20-/m0/s1.
What are the key properties of methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate has a molecular weight of 355.48 g/mol, XLogP of 4.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[3-amino-2,5-dimethyl-6-(4-methylphenyl)phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate is sourced from PubChem (CID 118562982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).