C28H36N2O6S2 — CID 11856329
(2S,5S)-1-amino-5-[[[(2S)-6-amino-5-hydroxy-2-[(2-methylphenyl)methyl]-3,4-dioxohexyl]disulfanyl]methyl]-2-hydroxy-6-(2-methylphenyl)hexane-3,4-dione (PubChem CID 11856329) has the molecular formula C28H36N2O6S2 and a molecular weight of 560.74 g/mol. Its IUPAC name is (2S,5S)-1-amino-5-[[[(2S)-6-amino-5-hydroxy-2-[(2-methylphenyl)methyl]-3,4-dioxohexyl]disulfanyl]methyl]-2-hydroxy-6-(2-methylphenyl)hexane-3,4-dione.
| Compound Name | (2S,5S)-1-amino-5-[[[(2S)-6-amino-5-hydroxy-2-[(2-methylphenyl)methyl]-3,4-dioxohexyl]disulfanyl]methyl]-2-hydroxy-6-(2-methylphenyl)hexane-3,4-dione |
|---|---|
| PubChem CID | 11856329 |
| Molecular Formula | C28H36N2O6S2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (2S,5S)-1-amino-5-[[[(2S)-6-amino-5-hydroxy-2-[(2-methylphenyl)methyl]-3,4-dioxohexyl]disulfanyl]methyl]-2-hydroxy-6-(2-methylphenyl)hexane-3,4-dione |
| SMILES | Cc1ccccc1C[C@H](CSSC[C@@H](Cc1ccccc1C)C(=O)C(=O)[C@@H](O)CN)C(=O)C(=O)C(O)CN |
| InChI | InChI=1S/C28H36N2O6S2/c1-17-7-3-5-9-19(17)11-21(25(33)27(35)23(31)13-29)15-37-38-16-22(26(34)28(36)24(32)14-30)12-20-10-6-4-8-18(20)2/h3-10,21-24,31-32H,11-16,29-30H2,1-2H3/t21-,22-,23+,24?/m1/s1 |
| InChIKey | OCPPDJKUZLIXOV-KEUGWDJXSA-N |
| XLogP | 1.62 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|