About methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate
methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate (PubChem CID 118563781) has the molecular formula C20H21NO5
and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate |
| PubChem CID | 118563781 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c[nH]c2ccc(OCc3cc(CO)cc(CO)c3)cc12 |
| InChI | InChI=1S/C20H21NO5/c1-25-20(24)7-16-9-21-19-3-2-17(8-18(16)19)26-12-15-5-13(10-22)4-14(6-15)11-23/h2-6,8-9,21-23H,7,10-12H2,1H3 |
| InChIKey | PWVJTSJJJIPICN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate?
The IUPAC name of methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate (CID 118563781) is methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate.
What is the SMILES notation for methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate?
The canonical SMILES for methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate is COC(=O)Cc1c[nH]c2ccc(OCc3cc(CO)cc(CO)c3)cc12.
What is the InChIKey of methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate?
The InChIKey is PWVJTSJJJIPICN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO5/c1-25-20(24)7-16-9-21-19-3-2-17(8-18(16)19)26-12-15-5-13(10-22)4-14(6-15)11-23/h2-6,8-9,21-23H,7,10-12H2,1H3.
What are the key properties of methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate?
methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate has a molecular weight of 355.39 g/mol, XLogP of 2.45, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-[[3,5-bis(hydroxymethyl)phenyl]methoxy]-1H-indol-3-yl]acetate is sourced from PubChem (CID 118563781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).