C23H24FN3O5S — CID 11856419
cis-(1R,2R)-1-fluoro-N-hydroxy-2-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide (PubChem CID 11856419) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is cis-(1R,2R)-1-fluoro-N-hydroxy-2-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,2R)-1-fluoro-N-hydroxy-2-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 11856419 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | cis-(1R,2R)-1-fluoro-N-hydroxy-2-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CCC[C@]3(F)C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H24FN3O5S/c1-15-13-16(19-5-2-3-6-20(19)25-15)14-32-17-8-10-18(11-9-17)33(30,31)27-21-7-4-12-23(21,24)22(28)26-29/h2-3,5-6,8-11,13,21,27,29H,4,7,12,14H2,1H3,(H,26,28)/t21-,23-/m1/s1 |
| InChIKey | RWCDLIMVIHXPPI-FYYLOGMGSA-N |
| XLogP | 3.17 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|