C25H21F5N8O — CID 118566170
4-amino-5-(6-cyclopropyl-3-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118566170) has the molecular formula C25H21F5N8O and a molecular weight of 544.49 g/mol. Its IUPAC name is 4-amino-5-(6-cyclopropyl-3-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(6-cyclopropyl-3-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118566170 |
| Molecular Formula | C25H21F5N8O |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 4-amino-5-(6-cyclopropyl-3-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(C3CC3)nc2)C(=O)Nc2nc(-c3cn4ccnc4c(CCC(F)(F)C(F)(F)F)n3)nc(N)c21 |
| InChI | InChI=1S/C25H21F5N8O/c1-23(13-4-5-14(33-10-13)12-2-3-12)17-18(31)35-19(36-20(17)37-22(23)39)16-11-38-9-8-32-21(38)15(34-16)6-7-24(26,27)25(28,29)30/h4-5,8-12H,2-3,6-7H2,1H3,(H3,31,35,36,37,39) |
| InChIKey | FIVOGQMCWDPUMB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|