C16H18O7 — CID 118566207
2,2-dimethyl-5-[(E)-3-(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione (PubChem CID 118566207) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-3-(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(E)-3-(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 118566207 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-3-(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)prop-2-enylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1=C(/C=C/C=C2C(=O)OC(C)(C)OC2=O)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C16H18O7/c1-9-10(12(17)21-15(2,3)20-9)7-6-8-11-13(18)22-16(4,5)23-14(11)19/h6-8H,1-5H3/b7-6+ |
| InChIKey | NGHRXTLLCMJGPV-VOTSOKGWSA-N |
| XLogP | 1.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|