About 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide
6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide (PubChem CID 118566606) has the molecular formula C20H23ClF2N2O3
and a molecular weight of 412.86 g/mol. Its IUPAC name is 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide |
| PubChem CID | 118566606 |
| Molecular Formula | C20H23ClF2N2O3 |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide |
| SMILES | COCCOc1ccc2c(C(=O)NCC3CCC(F)(F)CC3)c(Cl)ccc2n1 |
| InChI | InChI=1S/C20H23ClF2N2O3/c1-27-10-11-28-17-5-2-14-16(25-17)4-3-15(21)18(14)19(26)24-12-13-6-8-20(22,23)9-7-13/h2-5,13H,6-12H2,1H3,(H,24,26) |
| InChIKey | VITAFGZXCYTNKU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide?
The IUPAC name of 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide (CID 118566606) is 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide.
What is the SMILES notation for 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide?
The canonical SMILES for 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide is COCCOc1ccc2c(C(=O)NCC3CCC(F)(F)CC3)c(Cl)ccc2n1.
What is the InChIKey of 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide?
The InChIKey is VITAFGZXCYTNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClF2N2O3/c1-27-10-11-28-17-5-2-14-16(25-17)4-3-15(21)18(14)19(26)24-12-13-6-8-20(22,23)9-7-13/h2-5,13H,6-12H2,1H3,(H,24,26).
What are the key properties of 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide?
6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide has a molecular weight of 412.86 g/mol, XLogP of 4.47, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[(4,4-difluorocyclohexyl)methyl]-2-(2-methoxyethoxy)quinoline-5-carboxamide is sourced from PubChem (CID 118566606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).