C22H30F2O9 — CID 118566849
[(1S,2R,6R,8S,9S)-4-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-difluoropropanoate (PubChem CID 118566849) has the molecular formula C22H30F2O9 and a molecular weight of 476.47 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9S)-4-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-difluoropropanoate.
| Compound Name | [(1S,2R,6R,8S,9S)-4-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 118566849 |
| Molecular Formula | C22H30F2O9 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [(1S,2R,6R,8S,9S)-4-[2-(2-cyclohexylpropan-2-yloxy)-2-oxoethyl]-4-methyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-difluoropropanoate |
| SMILES | CC1(CC(=O)OC(C)(C)C2CCCCC2)O[C@H]2O[C@H]3[C@H](OC(=O)[C@H]3OC(=O)C(C)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C22H30F2O9/c1-20(2,11-8-6-5-7-9-11)31-12(25)10-21(3)32-16-14-13(29-18(16)33-21)15(17(26)28-14)30-19(27)22(4,23)24/h11,13-16,18H,5-10H2,1-4H3/t13-,14-,15-,16+,18+,21?/m0/s1 |
| InChIKey | RRZLOTDNEVQQKK-HAEHMJNHSA-N |
| XLogP | 2.63 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|