C19H24F2O9 — CID 118566850
propan-2-yl (1S,2R,6R,8S,9S)-9-(2,2-difluoropropanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate (PubChem CID 118566850) has the molecular formula C19H24F2O9 and a molecular weight of 434.39 g/mol. Its IUPAC name is propan-2-yl (1S,2R,6R,8S,9S)-9-(2,2-difluoropropanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate.
| Compound Name | propan-2-yl (1S,2R,6R,8S,9S)-9-(2,2-difluoropropanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 118566850 |
| Molecular Formula | C19H24F2O9 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | propan-2-yl (1S,2R,6R,8S,9S)-9-(2,2-difluoropropanoyloxy)-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
| SMILES | CC(C)OC(=O)C1CCC2(CC1)O[C@H]1O[C@H]3[C@H](OC(=O)[C@H]3OC(=O)C(C)(F)F)[C@H]1O2 |
| InChI | InChI=1S/C19H24F2O9/c1-8(2)25-14(22)9-4-6-19(7-5-9)29-13-11-10(27-16(13)30-19)12(15(23)26-11)28-17(24)18(3,20)21/h8-13,16H,4-7H2,1-3H3/t9?,10-,11-,12-,13+,16+,19?/m0/s1 |
| InChIKey | RTQRTLAUKZMSGR-ULGUCLLKSA-N |
| XLogP | 1.46 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|