C22H16ClF5N8O — CID 118566988
4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118566988) has the molecular formula C22H16ClF5N8O and a molecular weight of 538.87 g/mol. Its IUPAC name is 4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118566988 |
| Molecular Formula | C22H16ClF5N8O |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(Cl)cn2)C(=O)Nc2nc(-c3cn4ccnc4c(CCC(F)(F)C(F)(F)F)n3)nc(N)c21 |
| InChI | InChI=1S/C22H16ClF5N8O/c1-20(13-3-2-10(23)8-31-13)14-15(29)33-16(34-17(14)35-19(20)37)12-9-36-7-6-30-18(36)11(32-12)4-5-21(24,25)22(26,27)28/h2-3,6-9H,4-5H2,1H3,(H3,29,33,34,35,37) |
| InChIKey | QVULYZWFGKGTSW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|