C26H21F6N7O3 — CID 118567022
methyl 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-3-carboxylate (PubChem CID 118567022) has the molecular formula C26H21F6N7O3 and a molecular weight of 593.49 g/mol. Its IUPAC name is methyl 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-3-carboxylate.
| Compound Name | methyl 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-3-carboxylate |
|---|---|
| PubChem CID | 118567022 |
| Molecular Formula | C26H21F6N7O3 |
| Molecular Weight | 593.49 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | methyl 6-[4-amino-5-(4-fluorophenyl)-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-2-methyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc2c(CCC(F)(F)C(F)(F)F)nc(-c3nc(N)c4c(n3)NC(=O)C4(C)c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C26H21F6N7O3/c1-11-17(22(40)42-3)39-10-15(35-14(21(39)34-11)8-9-25(28,29)26(30,31)32)19-36-18(33)16-20(37-19)38-23(41)24(16,2)12-4-6-13(27)7-5-12/h4-7,10H,8-9H2,1-3H3,(H3,33,36,37,38,41) |
| InChIKey | LEBSQOCETOTCEQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|