C25H21F5N8O2 — CID 118567045
4-amino-5-cyclopropyl-5-(5-methoxy-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118567045) has the molecular formula C25H21F5N8O2 and a molecular weight of 560.49 g/mol. Its IUPAC name is 4-amino-5-cyclopropyl-5-(5-methoxy-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-cyclopropyl-5-(5-methoxy-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118567045 |
| Molecular Formula | C25H21F5N8O2 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 4-amino-5-cyclopropyl-5-(5-methoxy-2-pyridinyl)-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | COc1ccc(C2(C3CC3)C(=O)Nc3nc(-c4cn5ccnc5c(CCC(F)(F)C(F)(F)F)n4)nc(N)c32)nc1 |
| InChI | InChI=1S/C25H21F5N8O2/c1-40-13-4-5-16(33-10-13)24(12-2-3-12)17-18(31)35-19(36-20(17)37-22(24)39)15-11-38-9-8-32-21(38)14(34-15)6-7-23(26,27)25(28,29)30/h4-5,8-12H,2-3,6-7H2,1H3,(H3,31,35,36,37,39) |
| InChIKey | AJJVOJDMFCJPFZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|