C10H15N — CID 118567334
N-[(3Z,5Z)-octa-1,3,5-trien-2-yl]ethanimine (PubChem CID 118567334) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-[(3Z,5Z)-octa-1,3,5-trien-2-yl]ethanimine.
| Compound Name | N-[(3Z,5Z)-octa-1,3,5-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 118567334 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-[(3Z,5Z)-octa-1,3,5-trien-2-yl]ethanimine |
| SMILES | C=C(/C=C\C=C/CC)/N=C/C |
| InChI | InChI=1S/C10H15N/c1-4-6-7-8-9-10(3)11-5-2/h5-9H,3-4H2,1-2H3/b7-6-,9-8-,11-5+ |
| InChIKey | XPPJBDYFROJWMV-TXQBGFHRSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|