C26H37N3O2 — CID 11856745
(4-methylpiperidin-1-yl)-[2-(oxan-4-yl)-5-propyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone (PubChem CID 11856745) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[2-(oxan-4-yl)-5-propyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[2-(oxan-4-yl)-5-propyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
|---|---|
| PubChem CID | 11856745 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[2-(oxan-4-yl)-5-propyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
| SMILES | CCCn1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(C1CCOCC1)CC2 |
| InChI | InChI=1S/C26H37N3O2/c1-3-11-29-24-5-4-20(26(30)27-12-6-19(2)7-13-27)17-22(24)23-18-28(14-8-25(23)29)21-9-15-31-16-10-21/h4-5,17,19,21H,3,6-16,18H2,1-2H3 |
| InChIKey | LEYYJOBTMJQHCX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|