C22H28N2O3 — CID 118567566
9-[(3E)-3-ethenyl-2-hydroxyhexa-3,5-dienyl]-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 118567566) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 9-[(3E)-3-ethenyl-2-hydroxyhexa-3,5-dienyl]-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[(3E)-3-ethenyl-2-hydroxyhexa-3,5-dienyl]-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 118567566 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 9-[(3E)-3-ethenyl-2-hydroxyhexa-3,5-dienyl]-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=C/C=C(\C=C)C(O)CN1CCC2(CC1)CN(c1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C22H28N2O3/c1-3-8-18(4-2)20(25)15-23-13-11-22(12-14-23)17-24(21(26)16-27-22)19-9-6-5-7-10-19/h3-10,20,25H,1-2,11-17H2/b18-8+ |
| InChIKey | OGFKEXMOHUFLRJ-QGMBQPNBSA-N |
| XLogP | 2.54 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|