C18H29NO8S — CID 118567637
5-[2-(2,5-dioxopyrrol-1-yl)-2-methylbutoxy]-3,4,5-trimethyl-2-sulfohexanoic acid (PubChem CID 118567637) has the molecular formula C18H29NO8S and a molecular weight of 419.50 g/mol. Its IUPAC name is 5-[2-(2,5-dioxopyrrol-1-yl)-2-methylbutoxy]-3,4,5-trimethyl-2-sulfohexanoic acid.
| Compound Name | 5-[2-(2,5-dioxopyrrol-1-yl)-2-methylbutoxy]-3,4,5-trimethyl-2-sulfohexanoic acid |
|---|---|
| PubChem CID | 118567637 |
| Molecular Formula | C18H29NO8S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-[2-(2,5-dioxopyrrol-1-yl)-2-methylbutoxy]-3,4,5-trimethyl-2-sulfohexanoic acid |
| SMILES | CCC(C)(COC(C)(C)C(C)C(C)C(C(=O)O)S(=O)(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H29NO8S/c1-7-18(6,19-13(20)8-9-14(19)21)10-27-17(4,5)12(3)11(2)15(16(22)23)28(24,25)26/h8-9,11-12,15H,7,10H2,1-6H3,(H,22,23)(H,24,25,26) |
| InChIKey | CMBPBVXBESSCRJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|