C15H23N5 — CID 118567888
6-N-(3-aminopropyl)-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine (PubChem CID 118567888) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-N-(3-aminopropyl)-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine.
| Compound Name | 6-N-(3-aminopropyl)-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 118567888 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 6-N-(3-aminopropyl)-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine |
| SMILES | Cc1cccc(C2C=C(NCCCN)NC(N)=N2)c1C |
| InChI | InChI=1S/C15H23N5/c1-10-5-3-6-12(11(10)2)13-9-14(18-8-4-7-16)20-15(17)19-13/h3,5-6,9,13,18H,4,7-8,16H2,1-2H3,(H3,17,19,20) |
| InChIKey | OYYVGHGRUNQCTD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|