C21H27N5O3S — CID 118567900
[2-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]ethylamino] 4-methoxybenzenesulfinate (PubChem CID 118567900) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is [2-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]ethylamino] 4-methoxybenzenesulfinate.
| Compound Name | [2-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]ethylamino] 4-methoxybenzenesulfinate |
|---|---|
| PubChem CID | 118567900 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [2-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]ethylamino] 4-methoxybenzenesulfinate |
| SMILES | COc1ccc(S(=O)ONCCNC2=CC(c3cccc(C)c3C)N=C(N)N2)cc1 |
| InChI | InChI=1S/C21H27N5O3S/c1-14-5-4-6-18(15(14)2)19-13-20(26-21(22)25-19)23-11-12-24-29-30(27)17-9-7-16(28-3)8-10-17/h4-10,13,19,23-24H,11-12H2,1-3H3,(H3,22,25,26) |
| InChIKey | HRDPSESXNZPXGO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|