C23H30N6OS — CID 118568135
N-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]-3-(dimethylamino)benzenesulfinimidic acid (PubChem CID 118568135) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is N-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]-3-(dimethylamino)benzenesulfinimidic acid.
| Compound Name | N-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]-3-(dimethylamino)benzenesulfinimidic acid |
|---|---|
| PubChem CID | 118568135 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]-3-(dimethylamino)benzenesulfinimidic acid |
| SMILES | Cc1cccc(-c2cc(NCCC/N=S(\O)c3cccc(N(C)C)c3)nc(N)n2)c1C |
| InChI | InChI=1S/C23H30N6OS/c1-16-8-5-11-20(17(16)2)21-15-22(28-23(24)27-21)25-12-7-13-26-31(30)19-10-6-9-18(14-19)29(3)4/h5-6,8-11,14-15H,7,12-13H2,1-4H3,(H,26,30)(H3,24,25,27,28) |
| InChIKey | HNTCZWIGNVNPTL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|