C12H17N5 — CID 118568153
4-(5-amino-2-methylphenyl)-6-N-methyl-1,4-dihydropyrimidine-2,6-diamine (PubChem CID 118568153) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-(5-amino-2-methylphenyl)-6-N-methyl-1,4-dihydropyrimidine-2,6-diamine.
| Compound Name | 4-(5-amino-2-methylphenyl)-6-N-methyl-1,4-dihydropyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 118568153 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 4-(5-amino-2-methylphenyl)-6-N-methyl-1,4-dihydropyrimidine-2,6-diamine |
| SMILES | CNC1=CC(c2cc(N)ccc2C)N=C(N)N1 |
| InChI | InChI=1S/C12H17N5/c1-7-3-4-8(13)5-9(7)10-6-11(15-2)17-12(14)16-10/h3-6,10,15H,13H2,1-2H3,(H3,14,16,17) |
| InChIKey | PLLKLIWHTVFFAQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|