About N-methylprop-2-enimidoyl chloride
N-methylprop-2-enimidoyl chloride (PubChem CID 118568163) has the molecular formula C4H6ClN
and a molecular weight of 103.55 g/mol. Its IUPAC name is N-methylprop-2-enimidoyl chloride.
Molecular Properties
| Compound Name | N-methylprop-2-enimidoyl chloride |
| PubChem CID | 118568163 |
| Molecular Formula | C4H6ClN |
| Molecular Weight | 103.55 g/mol |
| Exact Mass | 103.02 |
| IUPAC Name | N-methylprop-2-enimidoyl chloride |
| SMILES | C=C/C(Cl)=N/C |
| InChI | InChI=1S/C4H6ClN/c1-3-4(5)6-2/h3H,1H2,2H3/b6-4- |
| InChIKey | UFGZAWAFTVBNNE-XQRVVYSFSA-N |
| XLogP | 1.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylprop-2-enimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylprop-2-enimidoyl chloride?
The IUPAC name of N-methylprop-2-enimidoyl chloride (CID 118568163) is N-methylprop-2-enimidoyl chloride.
What is the SMILES notation for N-methylprop-2-enimidoyl chloride?
The canonical SMILES for N-methylprop-2-enimidoyl chloride is C=C/C(Cl)=N/C.
What is the InChIKey of N-methylprop-2-enimidoyl chloride?
The InChIKey is UFGZAWAFTVBNNE-XQRVVYSFSA-N. The full InChI is InChI=1S/C4H6ClN/c1-3-4(5)6-2/h3H,1H2,2H3/b6-4-.
What are the key properties of N-methylprop-2-enimidoyl chloride?
N-methylprop-2-enimidoyl chloride has a molecular weight of 103.55 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylprop-2-enimidoyl chloride is sourced from PubChem (CID 118568163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).