C22H26N6 — CID 118568228
6-N-[3-(7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)propyl]-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine (PubChem CID 118568228) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-N-[3-(7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)propyl]-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine.
| Compound Name | 6-N-[3-(7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)propyl]-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 118568228 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 6-N-[3-(7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)propyl]-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidine-2,6-diamine |
| SMILES | Cc1cccc(C2C=C(NCCCC3n4c5ccccc5n43)NC(N)=N2)c1C |
| InChI | InChI=1S/C22H26N6/c1-14-7-5-8-16(15(14)2)17-13-20(26-22(23)25-17)24-12-6-11-21-27-18-9-3-4-10-19(18)28(21)27/h3-5,7-10,13,17,21,24H,6,11-12H2,1-2H3,(H3,23,25,26) |
| InChIKey | IHXOHSAGSLSXAR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|