C22H22ClFN6O2S — CID 118568270
(3R,6S)-3-[2-[(7-chloro-1,5-naphthyridin-4-yl)amino]-5-fluoro-4-pyridinyl]-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 118568270) has the molecular formula C22H22ClFN6O2S and a molecular weight of 488.98 g/mol. Its IUPAC name is (3R,6S)-3-[2-[(7-chloro-1,5-naphthyridin-4-yl)amino]-5-fluoro-4-pyridinyl]-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-[2-[(7-chloro-1,5-naphthyridin-4-yl)amino]-5-fluoro-4-pyridinyl]-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 118568270 |
| Molecular Formula | C22H22ClFN6O2S |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (3R,6S)-3-[2-[(7-chloro-1,5-naphthyridin-4-yl)amino]-5-fluoro-4-pyridinyl]-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(c2cc(Nc3ccnc4cc(Cl)cnc34)ncc2F)CS(=O)(=O)[C@@](C)(C2CC2)C(N)=N1 |
| InChI | InChI=1S/C22H22ClFN6O2S/c1-21(11-33(31,32)22(2,12-3-4-12)20(25)30-21)14-8-18(27-10-15(14)24)29-16-5-6-26-17-7-13(23)9-28-19(16)17/h5-10,12H,3-4,11H2,1-2H3,(H2,25,30)(H,26,27,29)/t21-,22-/m0/s1 |
| InChIKey | FCXFMBYBPKCVQJ-VXKWHMMOSA-N |
| XLogP | 3.73 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |