C14H17BrFN3O2S — CID 118568423
(3R,6S)-3-(5-bromo-2-fluoro-3-pyridinyl)-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 118568423) has the molecular formula C14H17BrFN3O2S and a molecular weight of 390.28 g/mol. Its IUPAC name is (3R,6S)-3-(5-bromo-2-fluoro-3-pyridinyl)-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(5-bromo-2-fluoro-3-pyridinyl)-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 118568423 |
| Molecular Formula | C14H17BrFN3O2S |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (3R,6S)-3-(5-bromo-2-fluoro-3-pyridinyl)-6-cyclopropyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(c2cc(Br)cnc2F)CS(=O)(=O)[C@@](C)(C2CC2)C(N)=N1 |
| InChI | InChI=1S/C14H17BrFN3O2S/c1-13(10-5-9(15)6-18-11(10)16)7-22(20,21)14(2,8-3-4-8)12(17)19-13/h5-6,8H,3-4,7H2,1-2H3,(H2,17,19)/t13-,14-/m0/s1 |
| InChIKey | BQQZLHAWYRZQGS-KBPBESRZSA-N |
| XLogP | 2.15 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|