C24H24FN7O2S — CID 118568427
8-[[6-[(3R,6S)-5-amino-6-cyclopropyl-6-(fluoromethyl)-3-methyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-methyl-2-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile (PubChem CID 118568427) has the molecular formula C24H24FN7O2S and a molecular weight of 493.57 g/mol. Its IUPAC name is 8-[[6-[(3R,6S)-5-amino-6-cyclopropyl-6-(fluoromethyl)-3-methyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-methyl-2-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 8-[[6-[(3R,6S)-5-amino-6-cyclopropyl-6-(fluoromethyl)-3-methyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-methyl-2-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118568427 |
| Molecular Formula | C24H24FN7O2S |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 8-[[6-[(3R,6S)-5-amino-6-cyclopropyl-6-(fluoromethyl)-3-methyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-5-methyl-2-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile |
| SMILES | Cc1ccc(Nc2nccc3cc(C#N)cnc23)nc1[C@]1(C)CS(=O)(=O)[C@@](CF)(C2CC2)C(N)=N1 |
| InChI | InChI=1S/C24H24FN7O2S/c1-14-3-6-18(31-21-19-16(7-8-28-21)9-15(10-26)11-29-19)30-20(14)23(2)13-35(33,34)24(12-25,17-4-5-17)22(27)32-23/h3,6-9,11,17H,4-5,12-13H2,1-2H3,(H2,27,32)(H,28,30,31)/t23-,24-/m0/s1 |
| InChIKey | RFERYZHFJUOUPR-ZEQRLZLVSA-N |
| XLogP | 3.07 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |