C27H36N4O4 — CID 118568528
N-[(3R)-5-(cyclobutylamino)-5-oxopent-1-en-3-yl]-5-(2,6-dimethoxyphenyl)-1-(3-methylcyclopentyl)pyrazole-3-carboxamide (PubChem CID 118568528) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[(3R)-5-(cyclobutylamino)-5-oxopent-1-en-3-yl]-5-(2,6-dimethoxyphenyl)-1-(3-methylcyclopentyl)pyrazole-3-carboxamide.
| Compound Name | N-[(3R)-5-(cyclobutylamino)-5-oxopent-1-en-3-yl]-5-(2,6-dimethoxyphenyl)-1-(3-methylcyclopentyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118568528 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-[(3R)-5-(cyclobutylamino)-5-oxopent-1-en-3-yl]-5-(2,6-dimethoxyphenyl)-1-(3-methylcyclopentyl)pyrazole-3-carboxamide |
| SMILES | C=C[C@@H](CC(=O)NC1CCC1)NC(=O)c1cc(-c2c(OC)cccc2OC)n(C2CCC(C)C2)n1 |
| InChI | InChI=1S/C27H36N4O4/c1-5-18(15-25(32)28-19-8-6-9-19)29-27(33)21-16-22(31(30-21)20-13-12-17(2)14-20)26-23(34-3)10-7-11-24(26)35-4/h5,7,10-11,16-20H,1,6,8-9,12-15H2,2-4H3,(H,28,32)(H,29,33)/t17?,18-,20?/m0/s1 |
| InChIKey | JAEUBALVSLXUSY-FDYSRKEFSA-N |
| XLogP | 4.27 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|