C29H46N4O4 — CID 118568882
5-(2,6-dimethoxyphenyl)-1-(2-methylbutyl)-N-[(3S)-5-methyl-1-oxo-1-(pentylamino)hexan-3-yl]pyrazole-3-carboxamide (PubChem CID 118568882) has the molecular formula C29H46N4O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is 5-(2,6-dimethoxyphenyl)-1-(2-methylbutyl)-N-[(3S)-5-methyl-1-oxo-1-(pentylamino)hexan-3-yl]pyrazole-3-carboxamide.
| Compound Name | 5-(2,6-dimethoxyphenyl)-1-(2-methylbutyl)-N-[(3S)-5-methyl-1-oxo-1-(pentylamino)hexan-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118568882 |
| Molecular Formula | C29H46N4O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | 5-(2,6-dimethoxyphenyl)-1-(2-methylbutyl)-N-[(3S)-5-methyl-1-oxo-1-(pentylamino)hexan-3-yl]pyrazole-3-carboxamide |
| SMILES | CCCCCNC(=O)C[C@H](CC(C)C)NC(=O)c1cc(-c2c(OC)cccc2OC)n(CC(C)CC)n1 |
| InChI | InChI=1S/C29H46N4O4/c1-8-10-11-15-30-27(34)17-22(16-20(3)4)31-29(35)23-18-24(33(32-23)19-21(5)9-2)28-25(36-6)13-12-14-26(28)37-7/h12-14,18,20-22H,8-11,15-17,19H2,1-7H3,(H,30,34)(H,31,35)/t21?,22-/m0/s1 |
| InChIKey | KOGBSYJTAHLOSW-KEKNWZKVSA-N |
| XLogP | 5.45 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|