About 3-phenyl-1-(2,2,2-trifluoroethyl)indazole
3-phenyl-1-(2,2,2-trifluoroethyl)indazole (PubChem CID 118568942) has the molecular formula C15H11F3N2
and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-phenyl-1-(2,2,2-trifluoroethyl)indazole.
Molecular Properties
| Compound Name | 3-phenyl-1-(2,2,2-trifluoroethyl)indazole |
| PubChem CID | 118568942 |
| Molecular Formula | C15H11F3N2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-phenyl-1-(2,2,2-trifluoroethyl)indazole |
| SMILES | FC(F)(F)Cn1nc(-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H11F3N2/c16-15(17,18)10-20-13-9-5-4-8-12(13)14(19-20)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | HQZIABLRBLTEIQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-1-(2,2,2-trifluoroethyl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1-(2,2,2-trifluoroethyl)indazole?
The IUPAC name of 3-phenyl-1-(2,2,2-trifluoroethyl)indazole (CID 118568942) is 3-phenyl-1-(2,2,2-trifluoroethyl)indazole.
What is the SMILES notation for 3-phenyl-1-(2,2,2-trifluoroethyl)indazole?
The canonical SMILES for 3-phenyl-1-(2,2,2-trifluoroethyl)indazole is FC(F)(F)Cn1nc(-c2ccccc2)c2ccccc21.
What is the InChIKey of 3-phenyl-1-(2,2,2-trifluoroethyl)indazole?
The InChIKey is HQZIABLRBLTEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N2/c16-15(17,18)10-20-13-9-5-4-8-12(13)14(19-20)11-6-2-1-3-7-11/h1-9H,10H2.
What are the key properties of 3-phenyl-1-(2,2,2-trifluoroethyl)indazole?
3-phenyl-1-(2,2,2-trifluoroethyl)indazole has a molecular weight of 276.26 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1-(2,2,2-trifluoroethyl)indazole is sourced from PubChem (CID 118568942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).